C20H19FN4O2S — CID 165379459
N-[(2-fluoro-3-pyridinyl)methyl]-2-[4-[methyl(propanoyl)amino]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 165379459) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[(2-fluoro-3-pyridinyl)methyl]-2-[4-[methyl(propanoyl)amino]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2-fluoro-3-pyridinyl)methyl]-2-[4-[methyl(propanoyl)amino]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 165379459 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[(2-fluoro-3-pyridinyl)methyl]-2-[4-[methyl(propanoyl)amino]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(=O)N(C)c1ccc(-c2nc(C(=O)NCc3cccnc3F)cs2)cc1 |
| InChI | InChI=1S/C20H19FN4O2S/c1-3-17(26)25(2)15-8-6-13(7-9-15)20-24-16(12-28-20)19(27)23-11-14-5-4-10-22-18(14)21/h4-10,12H,3,11H2,1-2H3,(H,23,27) |
| InChIKey | HOJJLAJVKNYMEX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|