C25H30N6O2 — CID 165380816
(7S,8R)-2-[[5-[(2S)-2-aminobutan-2-yl]-8-(cyclopropylamino)-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165380816) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is (7S,8R)-2-[[5-[(2S)-2-aminobutan-2-yl]-8-(cyclopropylamino)-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-[(2S)-2-aminobutan-2-yl]-8-(cyclopropylamino)-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165380816 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (7S,8R)-2-[[5-[(2S)-2-aminobutan-2-yl]-8-(cyclopropylamino)-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | CC[C@](C)(N)c1cnc(NC2CC2)c2cnc(Nc3ccc4c(n3)[C@@H](C)[C@H](C)OC4=O)cc12 |
| InChI | InChI=1S/C25H30N6O2/c1-5-25(4,26)19-12-28-23(29-15-6-7-15)18-11-27-21(10-17(18)19)30-20-9-8-16-22(31-20)13(2)14(3)33-24(16)32/h8-15H,5-7,26H2,1-4H3,(H,28,29)(H,27,30,31)/t13-,14-,25-/m0/s1 |
| InChIKey | NPZTYTWCQZSAPH-DZWULXIXSA-N |
| XLogP | 4.59 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |