C25H31N5O3 — CID 165380830
(7S,8R)-2-[[5-[(2R)-2-aminobutan-2-yl]-8-propoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165380830) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is (7S,8R)-2-[[5-[(2R)-2-aminobutan-2-yl]-8-propoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-[(2R)-2-aminobutan-2-yl]-8-propoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165380830 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (7S,8R)-2-[[5-[(2R)-2-aminobutan-2-yl]-8-propoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | CCCOc1ncc([C@](C)(N)CC)c2cc(Nc3ccc4c(n3)[C@@H](C)[C@H](C)OC4=O)ncc12 |
| InChI | InChI=1S/C25H31N5O3/c1-6-10-32-23-18-12-27-21(11-17(18)19(13-28-23)25(5,26)7-2)29-20-9-8-16-22(30-20)14(3)15(4)33-24(16)31/h8-9,11-15H,6-7,10,26H2,1-5H3,(H,27,29,30)/t14-,15-,25+/m0/s1 |
| InChIKey | XDDBLRRFGTWNMS-XSKAOVLVSA-N |
| XLogP | 4.80 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |