C26H30N6O2 — CID 165380833
(7S,8R)-2-[[5-[(1R)-1-amino-1-cyclopropylethyl]-8-(cyclopropylamino)-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165380833) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is (7S,8R)-2-[[5-[(1R)-1-amino-1-cyclopropylethyl]-8-(cyclopropylamino)-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-[(1R)-1-amino-1-cyclopropylethyl]-8-(cyclopropylamino)-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165380833 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (7S,8R)-2-[[5-[(1R)-1-amino-1-cyclopropylethyl]-8-(cyclopropylamino)-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | C[C@@H]1OC(=O)c2ccc(Nc3cc4c([C@](C)(N)C5CC5)cnc(NC5CC5)c4cn3)nc2[C@H]1C |
| InChI | InChI=1S/C26H30N6O2/c1-13-14(2)34-25(33)17-8-9-21(32-23(13)17)31-22-10-18-19(11-28-22)24(30-16-6-7-16)29-12-20(18)26(3,27)15-4-5-15/h8-16H,4-7,27H2,1-3H3,(H,29,30)(H,28,31,32)/t13-,14-,26+/m0/s1 |
| InChIKey | TYYJPOYXPUOKHL-AOTXYTFASA-N |
| XLogP | 4.59 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |