C27H31N5O4 — CID 165380838
(7S,8R)-2-[[5-[(1S)-1-amino-1-cyclopropylethyl]-8-(3-hydroxycyclobutyl)oxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165380838) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is (7S,8R)-2-[[5-[(1S)-1-amino-1-cyclopropylethyl]-8-(3-hydroxycyclobutyl)oxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-[(1S)-1-amino-1-cyclopropylethyl]-8-(3-hydroxycyclobutyl)oxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165380838 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (7S,8R)-2-[[5-[(1S)-1-amino-1-cyclopropylethyl]-8-(3-hydroxycyclobutyl)oxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | C[C@@H]1OC(=O)c2ccc(Nc3cc4c([C@@](C)(N)C5CC5)cnc(OC5CC(O)C5)c4cn3)nc2[C@H]1C |
| InChI | InChI=1S/C27H31N5O4/c1-13-14(2)35-26(34)18-6-7-22(32-24(13)18)31-23-10-19-20(11-29-23)25(36-17-8-16(33)9-17)30-12-21(19)27(3,28)15-4-5-15/h6-7,10-17,33H,4-5,8-9,28H2,1-3H3,(H,29,31,32)/t13-,14-,16?,17?,27-/m0/s1 |
| InChIKey | AGIGFJDMLQCTGT-MRAOXUTLSA-N |
| XLogP | 3.92 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |