C23H27F3N6O2 — CID 165380867
trans-(1R,3R)-3-[4-[[5-(2-aminopropan-2-yl)-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]pyrimidin-2-yl]cyclohexan-1-ol (PubChem CID 165380867) has the molecular formula C23H27F3N6O2 and a molecular weight of 476.50 g/mol. Its IUPAC name is trans-(1R,3R)-3-[4-[[5-(2-aminopropan-2-yl)-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]pyrimidin-2-yl]cyclohexan-1-ol.
| Compound Name | trans-(1R,3R)-3-[4-[[5-(2-aminopropan-2-yl)-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]pyrimidin-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 165380867 |
| Molecular Formula | C23H27F3N6O2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | trans-(1R,3R)-3-[4-[[5-(2-aminopropan-2-yl)-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]pyrimidin-2-yl]cyclohexan-1-ol |
| SMILES | CC(C)(N)c1cnc(OCC(F)(F)F)c2cnc(Nc3ccnc([C@@H]4CCC[C@@H](O)C4)n3)cc12 |
| InChI | InChI=1S/C23H27F3N6O2/c1-22(2,27)17-11-30-21(34-12-23(24,25)26)16-10-29-19(9-15(16)17)31-18-6-7-28-20(32-18)13-4-3-5-14(33)8-13/h6-7,9-11,13-14,33H,3-5,8,12,27H2,1-2H3,(H,28,29,31,32)/t13-,14-/m1/s1 |
| InChIKey | SXTWGKOSJPIAGN-ZIAGYGMSSA-N |
| XLogP | 4.32 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |