About 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine
4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine (PubChem CID 165380908) has the molecular formula C14H14ClF2N5O
and a molecular weight of 341.75 g/mol. Its IUPAC name is 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine.
Molecular Properties
| Compound Name | 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine |
| PubChem CID | 165380908 |
| Molecular Formula | C14H14ClF2N5O |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine |
| SMILES | CC(F)(F)COc1ncc(C(C)(C)N=[N+]=[N-])c2cc(Cl)ncc12 |
| InChI | InChI=1S/C14H14ClF2N5O/c1-13(2,21-22-18)10-6-20-12(23-7-14(3,16)17)9-5-19-11(15)4-8(9)10/h4-6H,7H2,1-3H3 |
| InChIKey | CGSDOOMOSKLMEN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine?
The IUPAC name of 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine (CID 165380908) is 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine.
What is the SMILES notation for 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine?
The canonical SMILES for 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine is CC(F)(F)COc1ncc(C(C)(C)N=[N+]=[N-])c2cc(Cl)ncc12.
What is the InChIKey of 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine?
The InChIKey is CGSDOOMOSKLMEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClF2N5O/c1-13(2,21-22-18)10-6-20-12(23-7-14(3,16)17)9-5-19-11(15)4-8(9)10/h4-6H,7H2,1-3H3.
What are the key properties of 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine?
4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine has a molecular weight of 341.75 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-azidopropan-2-yl)-6-chloro-1-(2,2-difluoropropoxy)-2,7-naphthyridine is sourced from PubChem (CID 165380908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).