C23H27N5O4 — CID 165380945
(7S,8R)-2-[[5-[(2S)-2-amino-1-methoxypropan-2-yl]-8-methoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165380945) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is (7S,8R)-2-[[5-[(2S)-2-amino-1-methoxypropan-2-yl]-8-methoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-[(2S)-2-amino-1-methoxypropan-2-yl]-8-methoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165380945 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | (7S,8R)-2-[[5-[(2S)-2-amino-1-methoxypropan-2-yl]-8-methoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | COC[C@@](C)(N)c1cnc(OC)c2cnc(Nc3ccc4c(n3)[C@@H](C)[C@H](C)OC4=O)cc12 |
| InChI | InChI=1S/C23H27N5O4/c1-12-13(2)32-22(29)14-6-7-18(28-20(12)14)27-19-8-15-16(9-25-19)21(31-5)26-10-17(15)23(3,24)11-30-4/h6-10,12-13H,11,24H2,1-5H3,(H,25,27,28)/t12-,13-,23+/m0/s1 |
| InChIKey | SRHUJGVLSQUUKW-VQNPYFGKSA-N |
| XLogP | 3.26 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |