C24H26F3N5O3 — CID 165380986
2-[[5-(2-aminopropan-2-yl)-8-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one (PubChem CID 165380986) has the molecular formula C24H26F3N5O3 and a molecular weight of 489.50 g/mol. Its IUPAC name is 2-[[5-(2-aminopropan-2-yl)-8-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one.
| Compound Name | 2-[[5-(2-aminopropan-2-yl)-8-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165380986 |
| Molecular Formula | C24H26F3N5O3 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[[5-(2-aminopropan-2-yl)-8-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| SMILES | C[C@@H](Oc1ncc(C(C)(C)N)c2cc(Nc3ccc4c(n3)CC(C)(C)OC4=O)ncc12)C(F)(F)F |
| InChI | InChI=1S/C24H26F3N5O3/c1-12(24(25,26)27)34-20-15-10-29-19(8-14(15)16(11-30-20)23(4,5)28)32-18-7-6-13-17(31-18)9-22(2,3)35-21(13)33/h6-8,10-12H,9,28H2,1-5H3,(H,29,31,32)/t12-/m1/s1 |
| InChIKey | WWTIRDDSHOOFRH-GFCCVEGCSA-N |
| XLogP | 4.78 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |