C22H25N5O3 — CID 165380995
(7S,8R)-2-[[5-[(1R)-1-aminopropyl]-8-methoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165380995) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is (7S,8R)-2-[[5-[(1R)-1-aminopropyl]-8-methoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-[(1R)-1-aminopropyl]-8-methoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165380995 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (7S,8R)-2-[[5-[(1R)-1-aminopropyl]-8-methoxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | CC[C@@H](N)c1cnc(OC)c2cnc(Nc3ccc4c(n3)[C@@H](C)[C@H](C)OC4=O)cc12 |
| InChI | InChI=1S/C22H25N5O3/c1-5-17(23)15-9-25-21(29-4)16-10-24-19(8-14(15)16)26-18-7-6-13-20(27-18)11(2)12(3)30-22(13)28/h6-12,17H,5,23H2,1-4H3,(H,24,26,27)/t11-,12-,17+/m0/s1 |
| InChIKey | ZGEGSXRELLQEIP-NVGCLXPQSA-N |
| XLogP | 3.85 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |