C11H10ClNO2 — CID 165380998
(2R,6R)-12-chloro-7-oxa-13-azatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-one (PubChem CID 165380998) has the molecular formula C11H10ClNO2 and a molecular weight of 223.66 g/mol. Its IUPAC name is (2R,6R)-12-chloro-7-oxa-13-azatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-one.
| Compound Name | (2R,6R)-12-chloro-7-oxa-13-azatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-one |
|---|---|
| PubChem CID | 165380998 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | (2R,6R)-12-chloro-7-oxa-13-azatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-one |
| SMILES | O=C1O[C@@H]2CCC[C@@H]2c2nc(Cl)ccc21 |
| InChI | InChI=1S/C11H10ClNO2/c12-9-5-4-7-10(13-9)6-2-1-3-8(6)15-11(7)14/h4-6,8H,1-3H2/t6-,8+/m0/s1 |
| InChIKey | JXTDXZVTGBMCPE-POYBYMJQSA-N |
| XLogP | 2.54 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|