C25H28FN5O3 — CID 165381017
(7S,8R)-2-[[5-(2-aminopropan-2-yl)-8-[(1-fluorocyclopropyl)methoxy]-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165381017) has the molecular formula C25H28FN5O3 and a molecular weight of 465.53 g/mol. Its IUPAC name is (7S,8R)-2-[[5-(2-aminopropan-2-yl)-8-[(1-fluorocyclopropyl)methoxy]-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-(2-aminopropan-2-yl)-8-[(1-fluorocyclopropyl)methoxy]-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165381017 |
| Molecular Formula | C25H28FN5O3 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (7S,8R)-2-[[5-(2-aminopropan-2-yl)-8-[(1-fluorocyclopropyl)methoxy]-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | C[C@@H]1OC(=O)c2ccc(Nc3cc4c(C(C)(C)N)cnc(OCC5(F)CC5)c4cn3)nc2[C@H]1C |
| InChI | InChI=1S/C25H28FN5O3/c1-13-14(2)34-23(32)15-5-6-19(31-21(13)15)30-20-9-16-17(10-28-20)22(33-12-25(26)7-8-25)29-11-18(16)24(3,4)27/h5-6,9-11,13-14H,7-8,12,27H2,1-4H3,(H,28,30,31)/t13-,14-/m0/s1 |
| InChIKey | FNLXGCBADHKMFX-KBPBESRZSA-N |
| XLogP | 4.51 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |