C25H29N5O4 — CID 165381119
(7R,8S)-2-[[5-[(2R)-2-amino-1-methoxypropan-2-yl]-8-cyclopropyloxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165381119) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is (7R,8S)-2-[[5-[(2R)-2-amino-1-methoxypropan-2-yl]-8-cyclopropyloxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7R,8S)-2-[[5-[(2R)-2-amino-1-methoxypropan-2-yl]-8-cyclopropyloxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165381119 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | (7R,8S)-2-[[5-[(2R)-2-amino-1-methoxypropan-2-yl]-8-cyclopropyloxy-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | COC[C@](C)(N)c1cnc(OC2CC2)c2cnc(Nc3ccc4c(n3)[C@H](C)[C@@H](C)OC4=O)cc12 |
| InChI | InChI=1S/C25H29N5O4/c1-13-14(2)33-24(31)16-7-8-20(30-22(13)16)29-21-9-17-18(10-27-21)23(34-15-5-6-15)28-11-19(17)25(3,26)12-32-4/h7-11,13-15H,5-6,12,26H2,1-4H3,(H,27,29,30)/t13-,14-,25+/m1/s1 |
| InChIKey | MLIWINRNGRTVIS-IEBYYPBYSA-N |
| XLogP | 3.79 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |