C22H25N5O2 — CID 165381275
(7S,8R)-2-[[5-[(1R)-1-aminopropyl]-8-methyl-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 165381275) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is (7S,8R)-2-[[5-[(1R)-1-aminopropyl]-8-methyl-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-[(1R)-1-aminopropyl]-8-methyl-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165381275 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (7S,8R)-2-[[5-[(1R)-1-aminopropyl]-8-methyl-2,7-naphthyridin-3-yl]amino]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | CC[C@@H](N)c1cnc(C)c2cnc(Nc3ccc4c(n3)[C@@H](C)[C@H](C)OC4=O)cc12 |
| InChI | InChI=1S/C22H25N5O2/c1-5-18(23)17-10-24-12(3)16-9-25-20(8-15(16)17)26-19-7-6-14-21(27-19)11(2)13(4)29-22(14)28/h6-11,13,18H,5,23H2,1-4H3,(H,25,26,27)/t11-,13-,18+/m0/s1 |
| InChIKey | CYOPMCBCPMDOLK-RRUGBERISA-N |
| XLogP | 4.15 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |