C12H17F2N3O — CID 165381881
(5R,11R)-14,14-difluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol (PubChem CID 165381881) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is (5R,11R)-14,14-difluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol.
| Compound Name | (5R,11R)-14,14-difluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol |
|---|---|
| PubChem CID | 165381881 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (5R,11R)-14,14-difluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1)C(F)(F)CC[C@@H](O)C3 |
| InChI | InChI=1S/C12H17F2N3O/c1-7-4-10-9(5-15-7)11-12(13,14)3-2-8(18)6-17(11)16-10/h7-8,15,18H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | MDAITPPZIAGJNO-HTQZYQBOSA-N |
| XLogP | 1.16 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |