C17H12F5N3S — CID 16538196
3-methyl-4-(4-methylphenyl)-5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-1,2,4-triazole (PubChem CID 16538196) has the molecular formula C17H12F5N3S and a molecular weight of 385.36 g/mol. Its IUPAC name is 3-methyl-4-(4-methylphenyl)-5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-methyl-4-(4-methylphenyl)-5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 16538196 |
| Molecular Formula | C17H12F5N3S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 3-methyl-4-(4-methylphenyl)-5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-1,2,4-triazole |
| SMILES | Cc1ccc(-n2c(C)nnc2SCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H12F5N3S/c1-8-3-5-10(6-4-8)25-9(2)23-24-17(25)26-7-11-12(18)14(20)16(22)15(21)13(11)19/h3-6H,7H2,1-2H3 |
| InChIKey | ZTFNKKRAIFEDFI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|