C24H33BN4O4 — CID 165382051
[(1R)-3-methyl-1-[[(2S)-4-methyl-2-[(2-pyrido[3,4-b]indol-9-ylacetyl)amino]pentanoyl]amino]butyl]boronic acid (PubChem CID 165382051) has the molecular formula C24H33BN4O4 and a molecular weight of 452.36 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2S)-4-methyl-2-[(2-pyrido[3,4-b]indol-9-ylacetyl)amino]pentanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2S)-4-methyl-2-[(2-pyrido[3,4-b]indol-9-ylacetyl)amino]pentanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 165382051 |
| Molecular Formula | C24H33BN4O4 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2S)-4-methyl-2-[(2-pyrido[3,4-b]indol-9-ylacetyl)amino]pentanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)Cn1c2ccccc2c2ccncc21)B(O)O |
| InChI | InChI=1S/C24H33BN4O4/c1-15(2)11-19(24(31)28-22(25(32)33)12-16(3)4)27-23(30)14-29-20-8-6-5-7-17(20)18-9-10-26-13-21(18)29/h5-10,13,15-16,19,22,32-33H,11-12,14H2,1-4H3,(H,27,30)(H,28,31)/t19-,22-/m0/s1 |
| InChIKey | SKVQUSHCRZFVBW-UGKGYDQZSA-N |
| XLogP | 2.26 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|