C52H31N7S — CID 165383238
4-[4-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridine (PubChem CID 165383238) has the molecular formula C52H31N7S and a molecular weight of 785.94 g/mol. Its IUPAC name is 4-[4-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridine.
| Compound Name | 4-[4-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridine |
|---|---|
| PubChem CID | 165383238 |
| Molecular Formula | C52H31N7S |
| Molecular Weight | 785.94 g/mol |
| Exact Mass | 785.24 |
| IUPAC Name | 4-[4-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cc5c(-c6ccccc6)nc6ccccc6c5c5nsnc45)cc3)nc(-c3cccc(-n4c5ccccc5c5ccccc54)c3)n2)cc1 |
| InChI | InChI=1S/C52H31N7S/c1-3-14-33(15-4-1)47-42-31-41(48-49(58-60-57-48)46(42)40-22-7-10-23-43(40)53-47)32-26-28-35(29-27-32)51-54-50(34-16-5-2-6-17-34)55-52(56-51)36-18-13-19-37(30-36)59-44-24-11-8-20-38(44)39-21-9-12-25-45(39)59/h1-31H |
| InChIKey | ZHHLGWYHCOUZBB-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.94 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|