C33H30F6NS+ — CID 165383634
15-(4-tert-butyl-1-methylnaphthalen-2-yl)-3,3,4,4,6,6-hexafluoro-5,5,14-trimethyl-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene (PubChem CID 165383634) has the molecular formula C33H30F6NS+ and a molecular weight of 586.67 g/mol. Its IUPAC name is 15-(4-tert-butyl-1-methylnaphthalen-2-yl)-3,3,4,4,6,6-hexafluoro-5,5,14-trimethyl-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene.
| Compound Name | 15-(4-tert-butyl-1-methylnaphthalen-2-yl)-3,3,4,4,6,6-hexafluoro-5,5,14-trimethyl-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 165383634 |
| Molecular Formula | C33H30F6NS+ |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 15-(4-tert-butyl-1-methylnaphthalen-2-yl)-3,3,4,4,6,6-hexafluoro-5,5,14-trimethyl-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
| SMILES | Cc1c(-c2c3sc4c5c(ccc4c3cc[n+]2C)C(F)(F)C(C)(C)C(F)(F)C5(F)F)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C33H30F6NS/c1-17-18-10-8-9-11-19(18)24(29(2,3)4)16-22(17)26-28-21(14-15-40(26)7)20-12-13-23-25(27(20)41-28)32(36,37)33(38,39)30(5,6)31(23,34)35/h8-16H,1-7H3/q+1 |
| InChIKey | XZYUFCIALXYTNO-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|