C24H17F8N — CID 165383651
6-cyclopentyl-1-(5,5,6,6,7,7,8,8-octafluoronaphthalen-2-yl)isoquinoline (PubChem CID 165383651) has the molecular formula C24H17F8N and a molecular weight of 471.39 g/mol. Its IUPAC name is 6-cyclopentyl-1-(5,5,6,6,7,7,8,8-octafluoronaphthalen-2-yl)isoquinoline.
| Compound Name | 6-cyclopentyl-1-(5,5,6,6,7,7,8,8-octafluoronaphthalen-2-yl)isoquinoline |
|---|---|
| PubChem CID | 165383651 |
| Molecular Formula | C24H17F8N |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 6-cyclopentyl-1-(5,5,6,6,7,7,8,8-octafluoronaphthalen-2-yl)isoquinoline |
| SMILES | FC1(F)c2ccc(-c3nccc4cc(C5CCCC5)ccc34)cc2C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H17F8N/c25-21(26)18-8-6-16(12-19(18)22(27,28)24(31,32)23(21,29)30)20-17-7-5-14(13-3-1-2-4-13)11-15(17)9-10-33-20/h5-13H,1-4H2 |
| InChIKey | NXMDJGGSMKFCKO-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|