C48H34N2 — CID 165384299
2,3,5,6-tetradeuterio-4-(9-phenylcarbazol-3-yl)-N-(3-phenylphenyl)-N-(4-phenylphenyl)aniline (PubChem CID 165384299) has the molecular formula C48H34N2 and a molecular weight of 642.84 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(9-phenylcarbazol-3-yl)-N-(3-phenylphenyl)-N-(4-phenylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-(9-phenylcarbazol-3-yl)-N-(3-phenylphenyl)-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 165384299 |
| Molecular Formula | C48H34N2 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(9-phenylcarbazol-3-yl)-N-(3-phenylphenyl)-N-(4-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2cccc(-c3ccccc3)c2)c([2H])c([2H])c1-c1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C48H34N2/c1-4-13-35(14-5-1)37-23-28-42(29-24-37)49(44-20-12-17-39(33-44)36-15-6-2-7-16-36)43-30-25-38(26-31-43)40-27-32-48-46(34-40)45-21-10-11-22-47(45)50(48)41-18-8-3-9-19-41/h1-34H/i25D,26D,30D,31D |
| InChIKey | VADCCKYCKPWMRK-DSIMOOQSSA-N |
| XLogP | 13.25 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |