C19H23ClFN7O — CID 165385734
5-chloro-4-[(3-fluoropiperidin-4-yl)methoxy]-N-[1-(3-isocyanocyclobutyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine (PubChem CID 165385734) has the molecular formula C19H23ClFN7O and a molecular weight of 419.89 g/mol. Its IUPAC name is 5-chloro-4-[(3-fluoropiperidin-4-yl)methoxy]-N-[1-(3-isocyanocyclobutyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine.
| Compound Name | 5-chloro-4-[(3-fluoropiperidin-4-yl)methoxy]-N-[1-(3-isocyanocyclobutyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 165385734 |
| Molecular Formula | C19H23ClFN7O |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-chloro-4-[(3-fluoropiperidin-4-yl)methoxy]-N-[1-(3-isocyanocyclobutyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine |
| SMILES | [C-]#[N+]C1CC(n2cc(Nc3ncc(Cl)c(OCC4CCNCC4F)n3)c(C)n2)C1 |
| InChI | InChI=1S/C19H23ClFN7O/c1-11-17(9-28(27-11)14-5-13(6-14)22-2)25-19-24-7-15(20)18(26-19)29-10-12-3-4-23-8-16(12)21/h7,9,12-14,16,23H,3-6,8,10H2,1H3,(H,24,25,26) |
| InChIKey | ZNCCNSQJAUVPQE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|