C19H20FN3O5 — CID 165386419
8-(4-acetyl-2-fluoroanilino)-2-(2-hydroxyethoxy)-7-methyl-3,4-dihydro-2,7-naphthyridine-1,6-dione (PubChem CID 165386419) has the molecular formula C19H20FN3O5 and a molecular weight of 389.38 g/mol. Its IUPAC name is 8-(4-acetyl-2-fluoroanilino)-2-(2-hydroxyethoxy)-7-methyl-3,4-dihydro-2,7-naphthyridine-1,6-dione.
| Compound Name | 8-(4-acetyl-2-fluoroanilino)-2-(2-hydroxyethoxy)-7-methyl-3,4-dihydro-2,7-naphthyridine-1,6-dione |
|---|---|
| PubChem CID | 165386419 |
| Molecular Formula | C19H20FN3O5 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 8-(4-acetyl-2-fluoroanilino)-2-(2-hydroxyethoxy)-7-methyl-3,4-dihydro-2,7-naphthyridine-1,6-dione |
| SMILES | CC(=O)c1ccc(Nc2c3c(cc(=O)n2C)CCN(OCCO)C3=O)c(F)c1 |
| InChI | InChI=1S/C19H20FN3O5/c1-11(25)12-3-4-15(14(20)9-12)21-18-17-13(10-16(26)22(18)2)5-6-23(19(17)27)28-8-7-24/h3-4,9-10,21,24H,5-8H2,1-2H3 |
| InChIKey | UFXRFZIHGYNAMO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|