C21H17BrFN3O2 — CID 165386552
8-(4-bromo-2-fluoroanilino)-7-methyl-4-phenyl-3,4-dihydro-2H-2,7-naphthyridine-1,6-dione (PubChem CID 165386552) has the molecular formula C21H17BrFN3O2 and a molecular weight of 442.29 g/mol. Its IUPAC name is 8-(4-bromo-2-fluoroanilino)-7-methyl-4-phenyl-3,4-dihydro-2H-2,7-naphthyridine-1,6-dione.
| Compound Name | 8-(4-bromo-2-fluoroanilino)-7-methyl-4-phenyl-3,4-dihydro-2H-2,7-naphthyridine-1,6-dione |
|---|---|
| PubChem CID | 165386552 |
| Molecular Formula | C21H17BrFN3O2 |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 8-(4-bromo-2-fluoroanilino)-7-methyl-4-phenyl-3,4-dihydro-2H-2,7-naphthyridine-1,6-dione |
| SMILES | Cn1c(Nc2ccc(Br)cc2F)c2c(cc1=O)C(c1ccccc1)CNC2=O |
| InChI | InChI=1S/C21H17BrFN3O2/c1-26-18(27)10-14-15(12-5-3-2-4-6-12)11-24-21(28)19(14)20(26)25-17-8-7-13(22)9-16(17)23/h2-10,15,25H,11H2,1H3,(H,24,28) |
| InChIKey | NEDBOCXNOJHVLA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|