C31H36N4O3 — CID 165387270
4-[3-(2-cyclopropylethylamino)-2-[4-[2-[4-[(3-methoxyazetidin-1-yl)methyl]phenyl]ethynyl]phenyl]propyl]-5-hydroxy-1H-pyrimidin-6-one (PubChem CID 165387270) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is 4-[3-(2-cyclopropylethylamino)-2-[4-[2-[4-[(3-methoxyazetidin-1-yl)methyl]phenyl]ethynyl]phenyl]propyl]-5-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 4-[3-(2-cyclopropylethylamino)-2-[4-[2-[4-[(3-methoxyazetidin-1-yl)methyl]phenyl]ethynyl]phenyl]propyl]-5-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 165387270 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 4-[3-(2-cyclopropylethylamino)-2-[4-[2-[4-[(3-methoxyazetidin-1-yl)methyl]phenyl]ethynyl]phenyl]propyl]-5-hydroxy-1H-pyrimidin-6-one |
| SMILES | COC1CN(Cc2ccc(C#Cc3ccc(C(CNCCC4CC4)Cc4nc[nH]c(=O)c4O)cc3)cc2)C1 |
| InChI | InChI=1S/C31H36N4O3/c1-38-28-19-35(20-28)18-25-8-6-22(7-9-25)2-3-23-10-12-26(13-11-23)27(17-32-15-14-24-4-5-24)16-29-30(36)31(37)34-21-33-29/h6-13,21,24,27-28,32,36H,4-5,14-20H2,1H3,(H,33,34,37) |
| InChIKey | TYVODPFSOUFDGF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|