About (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one
(3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one (PubChem CID 165387418) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one |
| PubChem CID | 165387418 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)[C@]1(C)CC(C)(C)NC1=O |
| InChI | InChI=1S/C10H19NO/c1-7(2)10(5)6-9(3,4)11-8(10)12/h7H,6H2,1-5H3,(H,11,12)/t10-/m0/s1 |
| InChIKey | SKNRLHSZUTYCSR-JTQLQIEISA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one?
The IUPAC name of (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one (CID 165387418) is (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one.
What is the SMILES notation for (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one?
The canonical SMILES for (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one is CC(C)[C@]1(C)CC(C)(C)NC1=O.
What is the InChIKey of (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one?
The InChIKey is SKNRLHSZUTYCSR-JTQLQIEISA-N. The full InChI is InChI=1S/C10H19NO/c1-7(2)10(5)6-9(3,4)11-8(10)12/h7H,6H2,1-5H3,(H,11,12)/t10-/m0/s1.
What are the key properties of (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one?
(3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one has a molecular weight of 169.27 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,5,5-trimethyl-3-propan-2-ylpyrrolidin-2-one is sourced from PubChem (CID 165387418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).