C16H14F3N5O3S — CID 165387764
N'-[3-(5-amino-1,3,4-oxadiazol-2-yl)-4-(trifluoromethyl)phenyl]-N'-methylbenzenesulfonohydrazide (PubChem CID 165387764) has the molecular formula C16H14F3N5O3S and a molecular weight of 413.38 g/mol. Its IUPAC name is N'-[3-(5-amino-1,3,4-oxadiazol-2-yl)-4-(trifluoromethyl)phenyl]-N'-methylbenzenesulfonohydrazide.
| Compound Name | N'-[3-(5-amino-1,3,4-oxadiazol-2-yl)-4-(trifluoromethyl)phenyl]-N'-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 165387764 |
| Molecular Formula | C16H14F3N5O3S |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N'-[3-(5-amino-1,3,4-oxadiazol-2-yl)-4-(trifluoromethyl)phenyl]-N'-methylbenzenesulfonohydrazide |
| SMILES | CN(NS(=O)(=O)c1ccccc1)c1ccc(C(F)(F)F)c(-c2nnc(N)o2)c1 |
| InChI | InChI=1S/C16H14F3N5O3S/c1-24(23-28(25,26)11-5-3-2-4-6-11)10-7-8-13(16(17,18)19)12(9-10)14-21-22-15(20)27-14/h2-9,23H,1H3,(H2,20,22) |
| InChIKey | DRFDAILSQVPWJO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|