About (4-fluoro-2,6-dimethylphenoxy)boronic acid
(4-fluoro-2,6-dimethylphenoxy)boronic acid (PubChem CID 165388238) has the molecular formula C8H10BFO3
and a molecular weight of 183.97 g/mol. Its IUPAC name is (4-fluoro-2,6-dimethylphenoxy)boronic acid.
Molecular Properties
| Compound Name | (4-fluoro-2,6-dimethylphenoxy)boronic acid |
| PubChem CID | 165388238 |
| Molecular Formula | C8H10BFO3 |
| Molecular Weight | 183.97 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (4-fluoro-2,6-dimethylphenoxy)boronic acid |
| SMILES | Cc1cc(F)cc(C)c1OB(O)O |
| InChI | InChI=1S/C8H10BFO3/c1-5-3-7(10)4-6(2)8(5)13-9(11)12/h3-4,11-12H,1-2H3 |
| InChIKey | XHVWBIZRVXVQON-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.97 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-2,6-dimethylphenoxy)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-2,6-dimethylphenoxy)boronic acid?
The IUPAC name of (4-fluoro-2,6-dimethylphenoxy)boronic acid (CID 165388238) is (4-fluoro-2,6-dimethylphenoxy)boronic acid.
What is the SMILES notation for (4-fluoro-2,6-dimethylphenoxy)boronic acid?
The canonical SMILES for (4-fluoro-2,6-dimethylphenoxy)boronic acid is Cc1cc(F)cc(C)c1OB(O)O.
What is the InChIKey of (4-fluoro-2,6-dimethylphenoxy)boronic acid?
The InChIKey is XHVWBIZRVXVQON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BFO3/c1-5-3-7(10)4-6(2)8(5)13-9(11)12/h3-4,11-12H,1-2H3.
What are the key properties of (4-fluoro-2,6-dimethylphenoxy)boronic acid?
(4-fluoro-2,6-dimethylphenoxy)boronic acid has a molecular weight of 183.97 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-2,6-dimethylphenoxy)boronic acid is sourced from PubChem (CID 165388238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).