C15H20O3 — CID 165388399
tert-butyl 2-[hydroxy-(3-methylphenyl)methyl]prop-2-enoate (PubChem CID 165388399) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is tert-butyl 2-[hydroxy-(3-methylphenyl)methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[hydroxy-(3-methylphenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 165388399 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | tert-butyl 2-[hydroxy-(3-methylphenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)C(O)c1cccc(C)c1 |
| InChI | InChI=1S/C15H20O3/c1-10-7-6-8-12(9-10)13(16)11(2)14(17)18-15(3,4)5/h6-9,13,16H,2H2,1,3-5H3 |
| InChIKey | GHZIYTDZGCCIBX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|