About 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline
5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline (PubChem CID 165388950) has the molecular formula C19H21ClFN3
and a molecular weight of 345.85 g/mol. Its IUPAC name is 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline.
Molecular Properties
| Compound Name | 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline |
| PubChem CID | 165388950 |
| Molecular Formula | C19H21ClFN3 |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline |
| SMILES | CN1CC2(CCN(c3ccc(Cl)cc3N)CC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C19H21ClFN3/c1-23-12-19(15-4-3-14(21)11-18(15)23)6-8-24(9-7-19)17-5-2-13(20)10-16(17)22/h2-5,10-11H,6-9,12,22H2,1H3 |
| InChIKey | PHAGGJFWVOYPKJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline?
The IUPAC name of 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline (CID 165388950) is 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline.
What is the SMILES notation for 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline?
The canonical SMILES for 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline is CN1CC2(CCN(c3ccc(Cl)cc3N)CC2)c2ccc(F)cc21.
What is the InChIKey of 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline?
The InChIKey is PHAGGJFWVOYPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClFN3/c1-23-12-19(15-4-3-14(21)11-18(15)23)6-8-24(9-7-19)17-5-2-13(20)10-16(17)22/h2-5,10-11H,6-9,12,22H2,1H3.
What are the key properties of 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline?
5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline has a molecular weight of 345.85 g/mol, XLogP of 4.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(6-fluoro-1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)aniline is sourced from PubChem (CID 165388950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).