C26H30F4O2 — CID 165389140
1-[3-fluoro-4-(2,3,4-trifluorophenyl)phenyl]-4-(5-propyloxan-2-yl)cyclohexan-1-ol (PubChem CID 165389140) has the molecular formula C26H30F4O2 and a molecular weight of 450.52 g/mol. Its IUPAC name is 1-[3-fluoro-4-(2,3,4-trifluorophenyl)phenyl]-4-(5-propyloxan-2-yl)cyclohexan-1-ol.
| Compound Name | 1-[3-fluoro-4-(2,3,4-trifluorophenyl)phenyl]-4-(5-propyloxan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 165389140 |
| Molecular Formula | C26H30F4O2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-[3-fluoro-4-(2,3,4-trifluorophenyl)phenyl]-4-(5-propyloxan-2-yl)cyclohexan-1-ol |
| SMILES | CCCC1CCC(C2CCC(O)(c3ccc(-c4ccc(F)c(F)c4F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C26H30F4O2/c1-2-3-16-4-9-23(32-15-16)17-10-12-26(31,13-11-17)18-5-6-19(22(28)14-18)20-7-8-21(27)25(30)24(20)29/h5-8,14,16-17,23,31H,2-4,9-13,15H2,1H3 |
| InChIKey | UPQKDKWWQSSARU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|