About 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one
2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one (PubChem CID 165389188) has the molecular formula C20H20F2N2O3
and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one |
| PubChem CID | 165389188 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one |
| SMILES | CCN1N=C(c2ccc(OC)c(F)c2)C(c2ccc(OC)c(F)c2)CC1=O |
| InChI | InChI=1S/C20H20F2N2O3/c1-4-24-19(25)11-14(12-5-7-17(26-2)15(21)9-12)20(23-24)13-6-8-18(27-3)16(22)10-13/h5-10,14H,4,11H2,1-3H3 |
| InChIKey | ZJQWLAQSBCCYKQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one?
The IUPAC name of 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one (CID 165389188) is 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one?
The canonical SMILES for 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one is CCN1N=C(c2ccc(OC)c(F)c2)C(c2ccc(OC)c(F)c2)CC1=O.
What is the InChIKey of 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one?
The InChIKey is ZJQWLAQSBCCYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F2N2O3/c1-4-24-19(25)11-14(12-5-7-17(26-2)15(21)9-12)20(23-24)13-6-8-18(27-3)16(22)10-13/h5-10,14H,4,11H2,1-3H3.
What are the key properties of 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one?
2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one has a molecular weight of 374.39 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,6-bis(3-fluoro-4-methoxyphenyl)-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 165389188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).