About N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide
N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide (PubChem CID 165390367) has the molecular formula C19H17F3N2O2S
and a molecular weight of 394.42 g/mol. Its IUPAC name is N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide.
Molecular Properties
| Compound Name | N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide |
| PubChem CID | 165390367 |
| Molecular Formula | C19H17F3N2O2S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide |
| SMILES | CCCCc1ccc2nc(NC(=O)c3cccc(OC(F)(F)F)c3)sc2c1 |
| InChI | InChI=1S/C19H17F3N2O2S/c1-2-3-5-12-8-9-15-16(10-12)27-18(23-15)24-17(25)13-6-4-7-14(11-13)26-19(20,21)22/h4,6-11H,2-3,5H2,1H3,(H,23,24,25) |
| InChIKey | BHMCEFUDXBQYKP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide?
The IUPAC name of N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide (CID 165390367) is N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide.
What is the SMILES notation for N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide?
The canonical SMILES for N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide is CCCCc1ccc2nc(NC(=O)c3cccc(OC(F)(F)F)c3)sc2c1.
What is the InChIKey of N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide?
The InChIKey is BHMCEFUDXBQYKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N2O2S/c1-2-3-5-12-8-9-15-16(10-12)27-18(23-15)24-17(25)13-6-4-7-14(11-13)26-19(20,21)22/h4,6-11H,2-3,5H2,1H3,(H,23,24,25).
What are the key properties of N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide?
N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide has a molecular weight of 394.42 g/mol, XLogP of 5.79, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-butyl-1,3-benzothiazol-2-yl)-3-(trifluoromethoxy)benzamide is sourced from PubChem (CID 165390367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).