About 4-methoxy-3,5-dinitro-1H-pyrazole
4-methoxy-3,5-dinitro-1H-pyrazole (PubChem CID 165390570) has the molecular formula C4H4N4O5
and a molecular weight of 188.10 g/mol. Its IUPAC name is 4-methoxy-3,5-dinitro-1H-pyrazole.
Molecular Properties
| Compound Name | 4-methoxy-3,5-dinitro-1H-pyrazole |
| PubChem CID | 165390570 |
| Molecular Formula | C4H4N4O5 |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 4-methoxy-3,5-dinitro-1H-pyrazole |
| SMILES | COc1c([N+](=O)[O-])n[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C4H4N4O5/c1-13-2-3(7(9)10)5-6-4(2)8(11)12/h1H3,(H,5,6) |
| InChIKey | RFFIOMSEQXPHRX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-3,5-dinitro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,5-dinitro-1H-pyrazole?
The IUPAC name of 4-methoxy-3,5-dinitro-1H-pyrazole (CID 165390570) is 4-methoxy-3,5-dinitro-1H-pyrazole.
What is the SMILES notation for 4-methoxy-3,5-dinitro-1H-pyrazole?
The canonical SMILES for 4-methoxy-3,5-dinitro-1H-pyrazole is COc1c([N+](=O)[O-])n[nH]c1[N+](=O)[O-].
What is the InChIKey of 4-methoxy-3,5-dinitro-1H-pyrazole?
The InChIKey is RFFIOMSEQXPHRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4O5/c1-13-2-3(7(9)10)5-6-4(2)8(11)12/h1H3,(H,5,6).
What are the key properties of 4-methoxy-3,5-dinitro-1H-pyrazole?
4-methoxy-3,5-dinitro-1H-pyrazole has a molecular weight of 188.10 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,5-dinitro-1H-pyrazole is sourced from PubChem (CID 165390570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).