About 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine
4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 165390855) has the molecular formula C23H19N5O
and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 165390855 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Cn1cc(-c2ncnc3[nH]c(-c4ccc(OCc5ccccc5)cc4)cc23)cn1 |
| InChI | InChI=1S/C23H19N5O/c1-28-13-18(12-26-28)22-20-11-21(27-23(20)25-15-24-22)17-7-9-19(10-8-17)29-14-16-5-3-2-4-6-16/h2-13,15H,14H2,1H3,(H,24,25,27) |
| InChIKey | YXIOXKFXWBWEEG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine (CID 165390855) is 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine is Cn1cc(-c2ncnc3[nH]c(-c4ccc(OCc5ccccc5)cc4)cc23)cn1.
What is the InChIKey of 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is YXIOXKFXWBWEEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N5O/c1-28-13-18(12-26-28)22-20-11-21(27-23(20)25-15-24-22)17-7-9-19(10-8-17)29-14-16-5-3-2-4-6-16/h2-13,15H,14H2,1H3,(H,24,25,27).
What are the key properties of 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine?
4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 381.44 g/mol, XLogP of 4.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methylpyrazol-4-yl)-6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 165390855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).