C28H14O3S4 — CID 165391687
(2Z,6E,7E)-7-ethylidene-2,6-bis(thieno[3,2-b]thiophen-5-ylmethylidene)-s-indacene-1,3,5-trione (PubChem CID 165391687) has the molecular formula C28H14O3S4 and a molecular weight of 526.69 g/mol. Its IUPAC name is (2Z,6E,7E)-7-ethylidene-2,6-bis(thieno[3,2-b]thiophen-5-ylmethylidene)-s-indacene-1,3,5-trione.
| Compound Name | (2Z,6E,7E)-7-ethylidene-2,6-bis(thieno[3,2-b]thiophen-5-ylmethylidene)-s-indacene-1,3,5-trione |
|---|---|
| PubChem CID | 165391687 |
| Molecular Formula | C28H14O3S4 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | (2Z,6E,7E)-7-ethylidene-2,6-bis(thieno[3,2-b]thiophen-5-ylmethylidene)-s-indacene-1,3,5-trione |
| SMILES | C/C=C1C(=C\c2cc3sccc3s2)/C(=O)c2cc3c(cc2/1)C(=O)/C(=C/c1cc2sccc2s1)C3=O |
| InChI | InChI=1S/C28H14O3S4/c1-2-15-16-11-19-20(28(31)21(27(19)30)8-14-10-25-23(35-14)4-6-33-25)12-18(16)26(29)17(15)7-13-9-24-22(34-13)3-5-32-24/h2-12H,1H3/b15-2+,17-7+,21-8- |
| InChIKey | FDTWCZSHIWWXKK-JXDATKDUSA-N |
| XLogP | 8.38 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|