C32H33F2N3O5SSi — CID 165391710
methyl 5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2,3-difluoro-4-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate (PubChem CID 165391710) has the molecular formula C32H33F2N3O5SSi and a molecular weight of 637.78 g/mol. Its IUPAC name is methyl 5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2,3-difluoro-4-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate.
| Compound Name | methyl 5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2,3-difluoro-4-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 165391710 |
| Molecular Formula | C32H33F2N3O5SSi |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | methyl 5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2,3-difluoro-4-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccnc3c2ccn3S(=O)(=O)c2ccccc2)n(COCC[Si](C)(C)C)c1-c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C32H33F2N3O5SSi/c1-21-11-12-25(29(34)28(21)33)30-26(32(38)41-2)19-27(36(30)20-42-17-18-44(3,4)5)23-13-15-35-31-24(23)14-16-37(31)43(39,40)22-9-7-6-8-10-22/h6-16,19H,17-18,20H2,1-5H3 |
| InChIKey | DXUDCZWVEFXGFJ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|