C27H32F2N4O2Si — CID 165391717
N-(2-fluoroethyl)-2-(2-fluoro-4-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide (PubChem CID 165391717) has the molecular formula C27H32F2N4O2Si and a molecular weight of 510.66 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2-(2-fluoro-4-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide.
| Compound Name | N-(2-fluoroethyl)-2-(2-fluoro-4-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 165391717 |
| Molecular Formula | C27H32F2N4O2Si |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-(2-fluoroethyl)-2-(2-fluoro-4-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
| SMILES | Cc1ccc(-c2c(C(=O)NCCF)cc(-c3ccnc4[nH]ccc34)n2COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C27H32F2N4O2Si/c1-18-5-6-21(23(29)15-18)25-22(27(34)32-12-9-28)16-24(33(25)17-35-13-14-36(2,3)4)19-7-10-30-26-20(19)8-11-31-26/h5-8,10-11,15-16H,9,12-14,17H2,1-4H3,(H,30,31)(H,32,34) |
| InChIKey | DWSGYHJDOGPGRE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|