C31H40FN5O2Si — CID 165391732
2-(2-fluoro-4-methylphenyl)-N-(1-methylpiperidin-4-yl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide (PubChem CID 165391732) has the molecular formula C31H40FN5O2Si and a molecular weight of 561.78 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylphenyl)-N-(1-methylpiperidin-4-yl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-methylphenyl)-N-(1-methylpiperidin-4-yl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 165391732 |
| Molecular Formula | C31H40FN5O2Si |
| Molecular Weight | 561.78 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | 2-(2-fluoro-4-methylphenyl)-N-(1-methylpiperidin-4-yl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxamide |
| SMILES | Cc1ccc(-c2c(C(=O)NC3CCN(C)CC3)cc(-c3ccnc4[nH]ccc34)n2COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C31H40FN5O2Si/c1-21-6-7-25(27(32)18-21)29-26(31(38)35-22-10-14-36(2)15-11-22)19-28(37(29)20-39-16-17-40(3,4)5)23-8-12-33-30-24(23)9-13-34-30/h6-9,12-13,18-19,22H,10-11,14-17,20H2,1-5H3,(H,33,34)(H,35,38) |
| InChIKey | WRVJRPRBTYPCFJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.78 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|