C28H32FN3O3Si — CID 165391747
2-(2-fluoro-4-methylphenyl)-4-prop-1-en-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid (PubChem CID 165391747) has the molecular formula C28H32FN3O3Si and a molecular weight of 505.67 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylphenyl)-4-prop-1-en-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid.
| Compound Name | 2-(2-fluoro-4-methylphenyl)-4-prop-1-en-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 165391747 |
| Molecular Formula | C28H32FN3O3Si |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2-(2-fluoro-4-methylphenyl)-4-prop-1-en-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
| SMILES | C=C(C)c1c(C(=O)O)c(-c2ccc(C)cc2F)n(COCC[Si](C)(C)C)c1-c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C28H32FN3O3Si/c1-17(2)23-24(28(33)34)26(21-8-7-18(3)15-22(21)29)32(16-35-13-14-36(4,5)6)25(23)19-9-11-30-27-20(19)10-12-31-27/h7-12,15H,1,13-14,16H2,2-6H3,(H,30,31)(H,33,34) |
| InChIKey | PKHSSLLYSPGLIF-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|