C27H30FN3O3Si — CID 165391778
4-ethenyl-2-(2-fluoro-4-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid (PubChem CID 165391778) has the molecular formula C27H30FN3O3Si and a molecular weight of 491.64 g/mol. Its IUPAC name is 4-ethenyl-2-(2-fluoro-4-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid.
| Compound Name | 4-ethenyl-2-(2-fluoro-4-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 165391778 |
| Molecular Formula | C27H30FN3O3Si |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 4-ethenyl-2-(2-fluoro-4-methylphenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
| SMILES | C=Cc1c(C(=O)O)c(-c2ccc(C)cc2F)n(COCC[Si](C)(C)C)c1-c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C27H30FN3O3Si/c1-6-18-23(27(32)33)25(21-8-7-17(2)15-22(21)28)31(16-34-13-14-35(3,4)5)24(18)19-9-11-29-26-20(19)10-12-30-26/h6-12,15H,1,13-14,16H2,2-5H3,(H,29,30)(H,32,33) |
| InChIKey | FQKLEMSAWDUSSI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|