C29H31N3O3Si — CID 165391823
2-(4-methylnaphthalen-1-yl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid (PubChem CID 165391823) has the molecular formula C29H31N3O3Si and a molecular weight of 497.67 g/mol. Its IUPAC name is 2-(4-methylnaphthalen-1-yl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid.
| Compound Name | 2-(4-methylnaphthalen-1-yl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 165391823 |
| Molecular Formula | C29H31N3O3Si |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 2-(4-methylnaphthalen-1-yl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(-c2c(C(=O)O)cc(-c3ccnc4[nH]ccc34)n2COCC[Si](C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C29H31N3O3Si/c1-19-9-10-23(21-8-6-5-7-20(19)21)27-25(29(33)34)17-26(32(27)18-35-15-16-36(2,3)4)22-11-13-30-28-24(22)12-14-31-28/h5-14,17H,15-16,18H2,1-4H3,(H,30,31)(H,33,34) |
| InChIKey | XVVVHBVVAWPNJK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|