C25H26FN3O5Si — CID 165391853
2-(3-carboxy-4-fluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid (PubChem CID 165391853) has the molecular formula C25H26FN3O5Si and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-(3-carboxy-4-fluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid.
| Compound Name | 2-(3-carboxy-4-fluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 165391853 |
| Molecular Formula | C25H26FN3O5Si |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-(3-carboxy-4-fluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccnc3[nH]ccc23)cc(C(=O)O)c1-c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H26FN3O5Si/c1-35(2,3)11-10-34-14-29-21(16-6-8-27-23-17(16)7-9-28-23)13-19(25(32)33)22(29)15-4-5-20(26)18(12-15)24(30)31/h4-9,12-13H,10-11,14H2,1-3H3,(H,27,28)(H,30,31)(H,32,33) |
| InChIKey | GQZQODDHADMVGZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|