C24H25F2N3O3Si — CID 165391954
2-(2,3-difluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid (PubChem CID 165391954) has the molecular formula C24H25F2N3O3Si and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid.
| Compound Name | 2-(2,3-difluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 165391954 |
| Molecular Formula | C24H25F2N3O3Si |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-(2,3-difluorophenyl)-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccnc3[nH]ccc23)cc(C(=O)O)c1-c1cccc(F)c1F |
| InChI | InChI=1S/C24H25F2N3O3Si/c1-33(2,3)12-11-32-14-29-20(15-7-9-27-23-16(15)8-10-28-23)13-18(24(30)31)22(29)17-5-4-6-19(25)21(17)26/h4-10,13H,11-12,14H2,1-3H3,(H,27,28)(H,30,31) |
| InChIKey | QFEGEMUTPKGBDI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|