C19H15FN2S — CID 165392471
4-(8-fluoroquinolin-3-yl)-2,2-dimethyl-1,3-benzothiazine (PubChem CID 165392471) has the molecular formula C19H15FN2S and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-(8-fluoroquinolin-3-yl)-2,2-dimethyl-1,3-benzothiazine.
| Compound Name | 4-(8-fluoroquinolin-3-yl)-2,2-dimethyl-1,3-benzothiazine |
|---|---|
| PubChem CID | 165392471 |
| Molecular Formula | C19H15FN2S |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-(8-fluoroquinolin-3-yl)-2,2-dimethyl-1,3-benzothiazine |
| SMILES | CC1(C)N=C(c2cnc3c(F)cccc3c2)c2ccccc2S1 |
| InChI | InChI=1S/C19H15FN2S/c1-19(2)22-17(14-7-3-4-9-16(14)23-19)13-10-12-6-5-8-15(20)18(12)21-11-13/h3-11H,1-2H3 |
| InChIKey | UYPBWPCGZBVIFZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |