C30H48 — CID 165392500
ethane;1-methyl-3-[(3E,5Z)-7-methylocta-1,3,5-trien-4-yl]-5-[(3E,5Z)-octa-1,3,5-trien-4-yl]benzene (PubChem CID 165392500) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is ethane;1-methyl-3-[(3E,5Z)-7-methylocta-1,3,5-trien-4-yl]-5-[(3E,5Z)-octa-1,3,5-trien-4-yl]benzene.
| Compound Name | ethane;1-methyl-3-[(3E,5Z)-7-methylocta-1,3,5-trien-4-yl]-5-[(3E,5Z)-octa-1,3,5-trien-4-yl]benzene |
|---|---|
| PubChem CID | 165392500 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | ethane;1-methyl-3-[(3E,5Z)-7-methylocta-1,3,5-trien-4-yl]-5-[(3E,5Z)-octa-1,3,5-trien-4-yl]benzene |
| SMILES | C=C/C=C(\C=C/CC)c1cc(C)cc(C(/C=C\C(C)C)=C/C=C)c1.CC.CC.CC |
| InChI | InChI=1S/C24H30.3C2H6/c1-7-10-13-21(11-8-2)23-16-20(6)17-24(18-23)22(12-9-3)15-14-19(4)5;3*1-2/h8-19H,2-3,7H2,1,4-6H3;3*1-2H3/b13-10-,15-14-,21-11+,22-12+;;; |
| InChIKey | CYXIOQHNTCLCGR-MOLVAHPYSA-N |
| XLogP | 10.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|