C23H24F4N6O3 — CID 165393142
7-fluoro-5-[1-[4-oxo-4-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]butoxy]ethyl]-2H-phthalazin-1-one (PubChem CID 165393142) has the molecular formula C23H24F4N6O3 and a molecular weight of 508.48 g/mol. Its IUPAC name is 7-fluoro-5-[1-[4-oxo-4-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]butoxy]ethyl]-2H-phthalazin-1-one.
| Compound Name | 7-fluoro-5-[1-[4-oxo-4-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]butoxy]ethyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 165393142 |
| Molecular Formula | C23H24F4N6O3 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 7-fluoro-5-[1-[4-oxo-4-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]butoxy]ethyl]-2H-phthalazin-1-one |
| SMILES | CC(OCCCC(=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1)c1cc(F)cc2c(=O)[nH]ncc12 |
| InChI | InChI=1S/C23H24F4N6O3/c1-14(17-9-16(24)10-18-19(17)13-30-31-21(18)35)36-8-2-3-20(34)32-4-6-33(7-5-32)22-28-11-15(12-29-22)23(25,26)27/h9-14H,2-8H2,1H3,(H,31,35) |
| InChIKey | KLHOTVBZFUIDRX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|