About (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate
(2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 16539331) has the molecular formula C14H13Cl2NO4
and a molecular weight of 330.17 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| PubChem CID | 16539331 |
| Molecular Formula | C14H13Cl2NO4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCC(=O)NC(=O)c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C14H13Cl2NO4/c1-13(8-14(13,15)16)12(20)21-7-10(18)17-11(19)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,17,18,19) |
| InChIKey | HAIYTRQNTXETRG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The IUPAC name of (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate (CID 16539331) is (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
What is the SMILES notation for (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The canonical SMILES for (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate is CC1(C(=O)OCC(=O)NC(=O)c2ccccc2)CC1(Cl)Cl.
What is the InChIKey of (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The InChIKey is HAIYTRQNTXETRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2NO4/c1-13(8-14(13,15)16)12(20)21-7-10(18)17-11(19)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,17,18,19).
What are the key properties of (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate?
(2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate has a molecular weight of 330.17 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamido-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 16539331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).