C10H20F3NO — CID 165393873
N-(3,3-dimethylbutan-2-yl)-2,2,2-trifluoroacetamide;ethane (PubChem CID 165393873) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2,2,2-trifluoroacetamide;ethane.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2,2,2-trifluoroacetamide;ethane |
|---|---|
| PubChem CID | 165393873 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2,2,2-trifluoroacetamide;ethane |
| SMILES | CC.CC(NC(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C8H14F3NO.C2H6/c1-5(7(2,3)4)12-6(13)8(9,10)11;1-2/h5H,1-4H3,(H,12,13);1-2H3 |
| InChIKey | ZYJJGOKZYYNISF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |