C16H14F5N5O3S — CID 165393978
2-ethylsulfonyl-6-methyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine (PubChem CID 165393978) has the molecular formula C16H14F5N5O3S and a molecular weight of 451.38 g/mol. Its IUPAC name is 2-ethylsulfonyl-6-methyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-ethylsulfonyl-6-methyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 165393978 |
| Molecular Formula | C16H14F5N5O3S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 2-ethylsulfonyl-6-methyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine |
| SMILES | CCS(=O)(=O)c1nn2cc(C)cnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H14F5N5O3S/c1-3-30(27,28)14-12(13-24-4-9(2)7-26(13)25-14)10-5-23-11(6-22-10)29-8-15(17,18)16(19,20)21/h4-7H,3,8H2,1-2H3 |
| InChIKey | XRXVLJWVWGTPEN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|